CAS 1797798-82-3 is the registry number for 7-Amino-8,8-dimethyl-2-oxabicyclo(4.2.0)octane-7-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-amino-8,8-dimethyl-2-oxabicyclo[4.2.0]octane-7-carboxylic acid;hydrochloride (CAS 1797798-82-3) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: 7-amino-8,8-dimethyl-2-oxabicyclo[4.2.0]octane-7-carboxylic acid;hydrochloride. InChIKey: BDIBRLUXQWFEJQ-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 7-amino-8,8-dimethyl-2-oxabicyclo[4.2.0]octane-7-carboxylic acid;hydrochloride |
| InChIKey | BDIBRLUXQWFEJQ-UHFFFAOYSA-N |
| SMILES | CC1(C2C(C1(C(=O)O)N)CCCO2)C.Cl |
Computed by PubChem (NCBI)