CAS 1808587-37-2 appears in our catalog under these names: (2S,3R)-2-(Piperidin-4-yl)tetrahydrofuran-3-carboxylic acid hydrochloride, 98%, rac-(2R,3S)-2-(Piperidin-4-yl)oxolane-3-carboxylic acid hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
(2S,3R)-2-piperidin-4-yloxolane-3-carboxylic acid;hydrochloride (CAS 1808587-37-2) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: (2S,3R)-2-piperidin-4-yloxolane-3-carboxylic acid;hydrochloride. InChIKey: LULCEWZXUXCYFT-RJUBDTSPSA-N.
| Molecular formula | C10H18ClNO3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | (2S,3R)-2-piperidin-4-yloxolane-3-carboxylic acid;hydrochloride |
| InChIKey | LULCEWZXUXCYFT-RJUBDTSPSA-N |
| SMILES | C1CO[C@H]([C@@H]1C(=O)O)C2CCNCC2.Cl |
Computed by PubChem (NCBI)