Products 1564939-81-6
CAS 1564939-81-6 is the registry number for 1-(4-(Hydroxymethyl)phenyl)tetrahydropyrimidin-2(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(hydroxymethyl)phenyl]-1,3-diazinan-2-one (CAS 1564939-81-6) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-[4-(hydroxymethyl)phenyl]-1,3-diazinan-2-one. InChIKey: FTWUAXYIWXLVQR-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-[4-(hydroxymethyl)phenyl]-1,3-diazinan-2-one |
| InChIKey | FTWUAXYIWXLVQR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)N(C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)