Products 1565980-23-5

CAS 1565980-23-5 appears in our catalog under these names: 4-Methoxycyclohexane-1-sulfonyl chloride, 95%, 4-Methoxycyclohexane-1-sulfonyl chloride, 97%, 4-Methoxycyclohexane-1-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,01g, 0,025g, 0,05g, 0,1g.

Structural formula: {0} (CAS {1})

4-methoxycyclohexane-1-sulfonyl chloride (CAS 1565980-23-5) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: 4-methoxycyclohexane-1-sulfonyl chloride. InChIKey: QHQFCIVYXHOXSN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO3S
Molecular weight212.70 g/mol
IUPAC name4-methoxycyclohexane-1-sulfonyl chloride
InChIKeyQHQFCIVYXHOXSN-UHFFFAOYSA-N
SMILESCOC1CCC(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)