Products 2031258-71-4

CAS 2031258-71-4 appears in our catalog under these names: 2-Cyclopropyl-2-ethoxyethane-1-sulfonyl chloride, 95%, 2-Cyclopropyl-2-ethoxyethane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2-cyclopropyl-2-ethoxyethanesulfonyl chloride (CAS 2031258-71-4) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: 2-cyclopropyl-2-ethoxyethanesulfonyl chloride. InChIKey: NEGTVBXNDXKLFT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO3S
Molecular weight212.70 g/mol
IUPAC name2-cyclopropyl-2-ethoxyethanesulfonyl chloride
InChIKeyNEGTVBXNDXKLFT-UHFFFAOYSA-N
SMILESCCOC(CS(=O)(=O)Cl)C1CC1

Computed by PubChem (NCBI)