Products 1600776-10-0

CAS 1600776-10-0 appears in our catalog under these names: (5,5-Dimethyloxolan-2-yl)methanesulfonyl chloride, 95%, (5,5-Dimethyloxolan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(5,5-dimethyloxolan-2-yl)methanesulfonyl chloride (CAS 1600776-10-0) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: (5,5-dimethyloxolan-2-yl)methanesulfonyl chloride. InChIKey: IPWDMXZXTKWWSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO3S
Molecular weight212.70 g/mol
IUPAC name(5,5-dimethyloxolan-2-yl)methanesulfonyl chloride
InChIKeyIPWDMXZXTKWWSZ-UHFFFAOYSA-N
SMILESCC1(CCC(O1)CS(=O)(=O)Cl)C

Computed by PubChem (NCBI)