Products 1934969-53-5

CAS 1934969-53-5 appears in our catalog under these names: (4,4-Dimethyloxolan-2-yl)methanesulfonyl chloride, 95%, (4,4-Dimethyloxolan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(4,4-dimethyloxolan-2-yl)methanesulfonyl chloride (CAS 1934969-53-5) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: (4,4-dimethyloxolan-2-yl)methanesulfonyl chloride. InChIKey: NOTCUCGOSSWGKT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13ClO3S
Molecular weight212.70 g/mol
IUPAC name(4,4-dimethyloxolan-2-yl)methanesulfonyl chloride
InChIKeyNOTCUCGOSSWGKT-UHFFFAOYSA-N
SMILESCC1(CC(OC1)CS(=O)(=O)Cl)C

Computed by PubChem (NCBI)