CAS 1934969-53-5 appears in our catalog under these names: (4,4-Dimethyloxolan-2-yl)methanesulfonyl chloride, 95%, (4,4-Dimethyloxolan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4,4-dimethyloxolan-2-yl)methanesulfonyl chloride (CAS 1934969-53-5) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: (4,4-dimethyloxolan-2-yl)methanesulfonyl chloride. InChIKey: NOTCUCGOSSWGKT-UHFFFAOYSA-N.
| Molecular formula | C7H13ClO3S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | (4,4-dimethyloxolan-2-yl)methanesulfonyl chloride |
| InChIKey | NOTCUCGOSSWGKT-UHFFFAOYSA-N |
| SMILES | CC1(CC(OC1)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)