CAS 2173999-64-7 is the registry number for rel-(1R,2S)-2-Ethoxycyclopentane-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Cis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride (CAS 2173999-64-7) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: cis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride. InChIKey: SVBYFMCLFLFISF-NKWVEPMBSA-N.
| Molecular formula | C7H13ClO3S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | cis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride |
| InChIKey | SVBYFMCLFLFISF-NKWVEPMBSA-N |
| SMILES | CCO[C@H]1CCC[C@H]1S(=O)(=O)Cl |
Computed by PubChem (NCBI)