Products 2173999-64-7

CAS 2173999-64-7 is the registry number for rel-(1R,2S)-2-Ethoxycyclopentane-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride (CAS 2173999-64-7) is a chemical compound with the molecular formula C7H13ClO3S and a molecular weight of 212.70 g/mol. IUPAC name: cis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride. InChIKey: SVBYFMCLFLFISF-NKWVEPMBSA-N.

Identity
Molecular formulaC7H13ClO3S
Molecular weight212.70 g/mol
IUPAC namecis-(1R,2S)-2-ethoxycyclopentane-1-sulfonyl chloride
InChIKeySVBYFMCLFLFISF-NKWVEPMBSA-N
SMILESCCO[C@H]1CCC[C@H]1S(=O)(=O)Cl

Computed by PubChem (NCBI)