Products 1568-36-1

CAS 1568-36-1 is the registry number for 1-(3-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

Methyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 1568-36-1) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: methyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: FCUJVRMNWKBRIU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H18ClNO4
Molecular weight371.8 g/mol
IUPAC namemethyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate
InChIKeyFCUJVRMNWKBRIU-UHFFFAOYSA-N
SMILESCC1=C(C2=C(N1C(=O)C3=CC(=CC=C3)Cl)C=CC(=C2)OC)CC(=O)OC

Computed by PubChem (NCBI)