CAS 1568-36-1 is the registry number for 1-(3-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Methyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 1568-36-1) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: methyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: FCUJVRMNWKBRIU-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO4 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | methyl 2-[1-(3-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | FCUJVRMNWKBRIU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC(=CC=C3)Cl)C=CC(=C2)OC)CC(=O)OC |
Computed by PubChem (NCBI)