CAS 7047-59-8 is the registry number for 6-Hydroxy-2,6-dimethyloct-7-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(3-chloro-4-methylphenyl)-2-oxo-7-propoxychromene-3-carboxamide (CAS 7047-59-8) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: N-(3-chloro-4-methylphenyl)-2-oxo-7-propoxychromene-3-carboxamide. InChIKey: NZVWSHGAAZDWNP-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO4 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | N-(3-chloro-4-methylphenyl)-2-oxo-7-propoxychromene-3-carboxamide |
| InChIKey | NZVWSHGAAZDWNP-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)NC3=CC(=C(C=C3)C)Cl |
Computed by PubChem (NCBI)