CAS 1601-18-9 appears in our catalog under these names: Indomethacin methyl ester, 98%, Indomethacin (Indometacin) EP Impurity H (Indomethacin Methyl Ester), Indomethacin Methyl Ester, >95% (HPLC), Methyl (1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl)acetate (Indomethacin Methyl Ester), Indomethacin methyl ester 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, on request, 10mg, 50mg, 5mg.
Methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 1601-18-9) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: OKHORWCUMZIORR-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO4 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | OKHORWCUMZIORR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OC |
Computed by PubChem (NCBI)