CAS 3059767-85-7 is the registry number for HEAL-116. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 50 mg, 10 mg.
3-[4-chloro-3-(morpholin-4-ylmethyl)phenyl]-7-hydroxychromen-4-one (CAS 3059767-85-7) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: 3-[4-chloro-3-(morpholin-4-ylmethyl)phenyl]-7-hydroxychromen-4-one. InChIKey: PCRWKAJAQDJMNV-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO4 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | 3-[4-chloro-3-(morpholin-4-ylmethyl)phenyl]-7-hydroxychromen-4-one |
| InChIKey | PCRWKAJAQDJMNV-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=C(C=CC(=C2)C3=COC4=C(C3=O)C=CC(=C4)O)Cl |
Computed by PubChem (NCBI)