CAS 25998-13-4 is the registry number for Ethyl 2-{1-[(4-chlorophenyl)carbonyl]-5-hydroxy-2-methylindol-3-yl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Ethyl 2-[1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate (CAS 25998-13-4) is a chemical compound with the molecular formula C20H18ClNO4 and a molecular weight of 371.8 g/mol. IUPAC name: ethyl 2-[1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate. InChIKey: CEBANNOORBJMCF-UHFFFAOYSA-N.
| Molecular formula | C20H18ClNO4 |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | ethyl 2-[1-(4-chlorobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetate |
| InChIKey | CEBANNOORBJMCF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(N(C2=C1C=C(C=C2)O)C(=O)C3=CC=C(C=C3)Cl)C |
Computed by PubChem (NCBI)