Products 1568944-22-8
CAS 1568944-22-8 is the registry number for Methyl 5-chloro-3-hydroxy-1H-indole-2-carboxylate, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Methyl 5-chloro-3-hydroxy-1H-indole-2-carboxylate (CAS 1568944-22-8) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: methyl 5-chloro-3-hydroxy-1H-indole-2-carboxylate. InChIKey: NKZWZUDAHGVKDG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | methyl 5-chloro-3-hydroxy-1H-indole-2-carboxylate |
| InChIKey | NKZWZUDAHGVKDG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)