Products 1643147-42-5
CAS 1643147-42-5 is the registry number for (2R)-2-[(3-Nitro-2-pyridyl)oxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2R)-2-[(3-nitro-2-pyridinyl)oxy]propanoic acid (CAS 1643147-42-5) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: (2R)-2-[(3-nitro-2-pyridinyl)oxy]propanoic acid. InChIKey: LFBCFZVCSJQICR-RXMQYKEDSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | (2R)-2-[(3-nitro-2-pyridinyl)oxy]propanoic acid |
| InChIKey | LFBCFZVCSJQICR-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)O)OC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)