Products 156916-81-3
CAS 156916-81-3 is the registry number for N-Cbz-D-Cysteine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid (CAS 156916-81-3) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid. InChIKey: UNLYAPBBIOKKDC-SECBINFHSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid |
| InChIKey | UNLYAPBBIOKKDC-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CS)C(=O)O |
Computed by PubChem (NCBI)