Products 96289-13-3

CAS 96289-13-3 is the registry number for 2-(((Benzyloxy)carbonyl)amino)-3-mercaptopropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid (CAS 96289-13-3) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid. InChIKey: UNLYAPBBIOKKDC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4S
Molecular weight255.29 g/mol
IUPAC name2-(phenylmethoxycarbonylamino)-3-sulfanylpropanoic acid
InChIKeyUNLYAPBBIOKKDC-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC(CS)C(=O)O

Computed by PubChem (NCBI)