CAS 1569434-60-1 is the registry number for 2,3,3-Trimethyl-6-nitroindoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,3-trimethyl-6-nitro-1,2-dihydroindole (CAS 1569434-60-1) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 2,3,3-trimethyl-6-nitro-1,2-dihydroindole. InChIKey: IFSQHOUTXPCUQI-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2,3,3-trimethyl-6-nitro-1,2-dihydroindole |
| InChIKey | IFSQHOUTXPCUQI-UHFFFAOYSA-N |
| SMILES | CC1C(C2=C(N1)C=C(C=C2)[N+](=O)[O-])(C)C |
Computed by PubChem (NCBI)