Products 156967-24-7
CAS 156967-24-7 is the registry number for Naproxen Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
Propan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CAS 156967-24-7) is a chemical compound with the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. IUPAC name: propan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: KABDXMXJNHRMMO-LBPRGKRZSA-N.
| Molecular formula | C17H20O3 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | propan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | KABDXMXJNHRMMO-LBPRGKRZSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OC(C)C |
Computed by PubChem (NCBI)