CAS 157066-48-3 is the registry number for 1-(β-D-2-Deoxyribofuranosyl)-3-nitropyrrole. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
(2R,3S,5S)-2-(hydroxymethyl)-5-(3-nitropyrrol-1-yl)oxolan-3-ol (CAS 157066-48-3) is a chemical compound with the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. IUPAC name: (2R,3S,5S)-2-(hydroxymethyl)-5-(3-nitropyrrol-1-yl)oxolan-3-ol. InChIKey: WETFHJRYOTYZFD-YIZRAAEISA-N.
| Molecular formula | C9H12N2O5 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | (2R,3S,5S)-2-(hydroxymethyl)-5-(3-nitropyrrol-1-yl)oxolan-3-ol |
| InChIKey | WETFHJRYOTYZFD-YIZRAAEISA-N |
| SMILES | C1[C@@H]([C@H](O[C@@H]1N2C=CC(=C2)[N+](=O)[O-])CO)O |
Computed by PubChem (NCBI)