CAS 157134-51-5 is the registry number for (S)-alpha-Methoxy-2-naphthylacetic acid. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
(2S)-2-methoxy-2-naphthalen-1-ylacetic acid (CAS 157134-51-5) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: (2S)-2-methoxy-2-naphthalen-1-ylacetic acid. InChIKey: MIQWXVUTCSGZIZ-LBPRGKRZSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | (2S)-2-methoxy-2-naphthalen-1-ylacetic acid |
| InChIKey | MIQWXVUTCSGZIZ-LBPRGKRZSA-N |
| SMILES | CO[C@@H](C1=CC=CC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)