Products 157198-79-3

CAS 157198-79-3 is the registry number for 2-(1H-Benzimidazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(benzimidazol-1-yl)propanoic acid (CAS 157198-79-3) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-(benzimidazol-1-yl)propanoic acid. InChIKey: KPWHLUYPAQJXFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O2
Molecular weight190.20 g/mol
IUPAC name2-(benzimidazol-1-yl)propanoic acid
InChIKeyKPWHLUYPAQJXFJ-UHFFFAOYSA-N
SMILESCC(C(=O)O)N1C=NC2=CC=CC=C21

Computed by PubChem (NCBI)