CAS 157435-10-4 is the registry number for XK469. Offered by: MedChemExpress. Available pack sizes: 5 mg.
2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid (CAS 157435-10-4) is a chemical compound with the molecular formula C17H13ClN2O4 and a molecular weight of 344.7 g/mol. IUPAC name: 2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid. InChIKey: NUQZXROIVGBRGR-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O4 |
|---|---|
| Molecular weight | 344.7 g/mol |
| IUPAC name | 2-[4-(7-chloroquinoxalin-2-yl)oxyphenoxy]propanoic acid |
| InChIKey | NUQZXROIVGBRGR-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)OC2=CN=C3C=CC(=CC3=N2)Cl |
Computed by PubChem (NCBI)