Products 2342576-75-2
CAS 2342576-75-2 is the registry number for ASM-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-1,2-oxazole-5-carboxamide (CAS 2342576-75-2) is a chemical compound with the molecular formula C17H13ClN2O4 and a molecular weight of 344.7 g/mol. IUPAC name: 3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-1,2-oxazole-5-carboxamide. InChIKey: XZENCCSBEQTERZ-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O4 |
|---|---|
| Molecular weight | 344.7 g/mol |
| IUPAC name | 3-[[4-(4-chlorophenyl)phenyl]methoxy]-N-hydroxy-1,2-oxazole-5-carboxamide |
| InChIKey | XZENCCSBEQTERZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=NOC(=C2)C(=O)NO)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)