CAS 1803599-75-8 appears in our catalog under these names: 2-Chloro-3-(2-methoxy-5-nitrophenoxymethyl)quinoline, 95%, 2-Chloro-3-(2-methoxy-5-nitrophenoxymethyl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-3-[(2-methoxy-5-nitrophenoxy)methyl]quinoline (CAS 1803599-75-8) is a chemical compound with the molecular formula C17H13ClN2O4 and a molecular weight of 344.7 g/mol. IUPAC name: 2-chloro-3-[(2-methoxy-5-nitrophenoxy)methyl]quinoline. InChIKey: KNYWIVMDJIFPTE-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O4 |
|---|---|
| Molecular weight | 344.7 g/mol |
| IUPAC name | 2-chloro-3-[(2-methoxy-5-nitrophenoxy)methyl]quinoline |
| InChIKey | KNYWIVMDJIFPTE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCC2=CC3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)