Products 2712290-12-3
CAS 2712290-12-3 appears in our catalog under these names: 4-(4-Amino-3-chlorophenoxy)-7-methoxyquinoline-6-carboxylic acid 95%, 4-(4-Amino-3-chlorophenoxy)-7-methoxyquinoline-6-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carboxylic acid (CAS 2712290-12-3) is a chemical compound with the molecular formula C17H13ClN2O4 and a molecular weight of 344.7 g/mol. IUPAC name: 4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carboxylic acid. InChIKey: ALKWSVVEKYJRCN-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O4 |
|---|---|
| Molecular weight | 344.7 g/mol |
| IUPAC name | 4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carboxylic acid |
| InChIKey | ALKWSVVEKYJRCN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1C(=O)O)OC3=CC(=C(C=C3)N)Cl |
Computed by PubChem (NCBI)