Products 2714483-62-0
CAS 2714483-62-0 appears in our catalog under these names: Quizalofop (free acid) D3 100 µg/mL in Acetone, D3-Quizalofop (free acid), Concentration: 100 µg/ml Solvent: Acetone. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1ml, 1x1ml.
2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3,3,3-trideuteriopropanoic acid (CAS 2714483-62-0) is a chemical compound with the molecular formula C17H13ClN2O4 and a molecular weight of 347.8 g/mol. IUPAC name: 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3,3,3-trideuteriopropanoic acid. InChIKey: ABOOPXYCKNFDNJ-FIBGUPNXSA-N.
| Molecular formula | C17H13ClN2O4 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3,3,3-trideuteriopropanoic acid |
| InChIKey | ABOOPXYCKNFDNJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)OC1=CC=C(C=C1)OC2=CN=C3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)