CAS 157518-45-1 appears in our catalog under these names: 5-Fluoro-2-methoxycinnamic acid, 95%, 5–Fluoro–2–Methoxycinnamic Acid, 3-(5-Fluoro-2-methoxyphenyl)acrylic acid 98% (E), 5-Fluoro-2-Methoxycinnamic Acid, 98% (E), 98% (E). Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 2.5g.
(E)-3-(5-fluoro-2-methoxyphenyl)prop-2-enoic acid (CAS 157518-45-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(5-fluoro-2-methoxyphenyl)prop-2-enoic acid. InChIKey: WWZPWGXNJORULY-GORDUTHDSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (E)-3-(5-fluoro-2-methoxyphenyl)prop-2-enoic acid |
| InChIKey | WWZPWGXNJORULY-GORDUTHDSA-N |
| SMILES | COC1=C(C=C(C=C1)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)