Products 15769-56-9
CAS 15769-56-9 appears in our catalog under these names: Guluronic acid, Guluronic acid, 98.90%, Guluronic acid, ≥98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 5 mg.
(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (CAS 15769-56-9) is a chemical compound with the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. IUPAC name: (2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid. InChIKey: IAJILQKETJEXLJ-KLVWXMOXSA-N.
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| InChIKey | IAJILQKETJEXLJ-KLVWXMOXSA-N |
| SMILES | C(=O)[C@@H]([C@@H]([C@H]([C@@H](C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)