Products 6814-36-4
CAS 6814-36-4 is the registry number for Mannuronic acid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (CAS 6814-36-4) is a chemical compound with the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. IUPAC name: (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid. InChIKey: IAJILQKETJEXLJ-MBMOQRBOSA-N.
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (2S,3S,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| InChIKey | IAJILQKETJEXLJ-MBMOQRBOSA-N |
| SMILES | C(=O)[C@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)