CAS 70332-45-5 appears in our catalog under these names: L-Glucuronic Acid, L-Glucuronic acid sodium salt. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
(2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (CAS 70332-45-5) is a chemical compound with the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. IUPAC name: (2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid. InChIKey: IAJILQKETJEXLJ-KKQCNMDGSA-N.
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| InChIKey | IAJILQKETJEXLJ-KKQCNMDGSA-N |
| SMILES | C(=O)[C@H]([C@@H]([C@H]([C@H](C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)