Products 36562-70-6
CAS 36562-70-6 appears in our catalog under these names: Polyguluronic acid, Polyguluronic acid, min. 80 %, 5 g, Polyguluronic acid, min. 80 %, 10 g, Polyguluronic acid, min. 80 %, 25 g. Offered by: Biosynth, Roth. Available pack sizes: 5g, 25g, 10g, 50g, 100g.
(2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (CAS 36562-70-6) is a chemical compound with the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. IUPAC name: (2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid. InChIKey: IAJILQKETJEXLJ-KLVWXMOXSA-N.
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (2S,3R,4R,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| InChIKey | IAJILQKETJEXLJ-KLVWXMOXSA-N |
| SMILES | C(=O)[C@@H]([C@@H]([C@H]([C@@H](C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)