Products 15783-70-7
CAS 15783-70-7 is the registry number for 5-Amino-3-phenyl-1,2-oxazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-amino-3-phenyl-1,2-oxazole-4-carboxamide (CAS 15783-70-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 5-amino-3-phenyl-1,2-oxazole-4-carboxamide. InChIKey: CTYHRZLZAZQSPO-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 5-amino-3-phenyl-1,2-oxazole-4-carboxamide |
| InChIKey | CTYHRZLZAZQSPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2C(=O)N)N |
Computed by PubChem (NCBI)