CAS 15794-14-6 appears in our catalog under these names: 7–Hydrazinylquinoline hydrochloride, 7-Hydrazinylquinoline hydrochloride 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg.
Quinolin-7-ylhydrazine;hydrochloride (CAS 15794-14-6) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: quinolin-7-ylhydrazine;hydrochloride. InChIKey: OHRVBHXQGNHQGI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | quinolin-7-ylhydrazine;hydrochloride |
| InChIKey | OHRVBHXQGNHQGI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)NN)N=C1.Cl |
Computed by PubChem (NCBI)