Products 157988-96-0
CAS 157988-96-0 is the registry number for 8-amino-5-hydroxy-1,2,3,4-tetrahydronaphthalen-1-one, >95%. Offered by: Chemat. Available pack sizes: 100mg.
8-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one (CAS 157988-96-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 8-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: PLIBWFJWJBJPQS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 8-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | PLIBWFJWJBJPQS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2C(=O)C1)N)O |
Computed by PubChem (NCBI)