Products 1580-42-3
CAS 1580-42-3 appears in our catalog under these names: 5-Chloro-2-hydroxy-N-(3-(trifluoromethyl)phenyl)benzamide, SARS-CoV-2-IN-15, 99.65%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 0,5g, 25 mg, 50 mg, 10 mg, 100 mg, 5 mg.
5-chloro-2-hydroxy-N-[3-(trifluoromethyl)phenyl]benzamide (CAS 1580-42-3) is a chemical compound with the molecular formula C14H9ClF3NO2 and a molecular weight of 315.67 g/mol. IUPAC name: 5-chloro-2-hydroxy-N-[3-(trifluoromethyl)phenyl]benzamide. InChIKey: OAMVIBKEICGPKK-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO2 |
|---|---|
| Molecular weight | 315.67 g/mol |
| IUPAC name | 5-chloro-2-hydroxy-N-[3-(trifluoromethyl)phenyl]benzamide |
| InChIKey | OAMVIBKEICGPKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=C(C=CC(=C2)Cl)O)C(F)(F)F |
Computed by PubChem (NCBI)