Products 15802-69-4

CAS 15802-69-4 is the registry number for Nitrendipine Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2-[(4-nitrophenyl)methylidene]-3-oxobutanoate (CAS 15802-69-4) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: ethyl 2-[(4-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: CHERQVMXMRXBFX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO5
Molecular weight263.25 g/mol
IUPAC nameethyl 2-[(4-nitrophenyl)methylidene]-3-oxobutanoate
InChIKeyCHERQVMXMRXBFX-UHFFFAOYSA-N
SMILESCCOC(=O)C(=CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)C

Computed by PubChem (NCBI)