CAS 158038-67-6 appears in our catalog under these names: 4-(Toluene-4-sulfonylamino)-benzoic acid methyl ester, 95%, Methyl 4-(4-methylbenzenesulfonamido)benzoate, 4-(TOLUENE-4-SULFONYLAMINO)-BENZOIC ACID METHYL ESTER, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 1g, 2,5g, 250mg.
Methyl 4-[(4-methylphenyl)sulfonylamino]benzoate (CAS 158038-67-6) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: methyl 4-[(4-methylphenyl)sulfonylamino]benzoate. InChIKey: MMJJVODPBHNFCY-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | methyl 4-[(4-methylphenyl)sulfonylamino]benzoate |
| InChIKey | MMJJVODPBHNFCY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)