CAS 15817-48-8 appears in our catalog under these names: 2-(2,4-Dimethylbenzoyl)furan, 95%, 2-(2,4-Dimethylbenzoyl)furan. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
(2,4-dimethylphenyl)-(furan-2-yl)methanone (CAS 15817-48-8) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: (2,4-dimethylphenyl)-(furan-2-yl)methanone. InChIKey: XDTAFJKNEOCGPK-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | (2,4-dimethylphenyl)-(furan-2-yl)methanone |
| InChIKey | XDTAFJKNEOCGPK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2=CC=CO2)C |
Computed by PubChem (NCBI)