CAS 158580-57-5 appears in our catalog under these names: Methyl 4-bromo-2-nitrobenzoate, Methyl 4-bromo-2-nitrobenzoate 98%, Methyl 4-Bromo-2-nitrobenzoate, 98%, 98%, Methyl 4-bromo-2-nitrobenzoate, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250g, 100g, 1g, 5g, 10g, 25g, 50g.
Methyl 4-bromo-2-nitrobenzoate (CAS 158580-57-5) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: methyl 4-bromo-2-nitrobenzoate. InChIKey: YTWDMAAPIWOIFZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | methyl 4-bromo-2-nitrobenzoate |
| InChIKey | YTWDMAAPIWOIFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)