CAS 15862-18-7 appears in our catalog under these names: 5,5'–Dibromo–2,2'–bipyridine, 5,5'-Dibromo-2,2'-bipyridyl, >98.0%(HPLC), 5,5'-Dibromo-2,2'-bipyridine 97%, 5,5'-Dibromo-2,2'-bipyridine, 97%, 97%, 5,5'-Dibromo-2,2'-bipyridine, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100g, 100mg, 250mg, 25g, 50g.
5-bromo-2-(5-bromo-2-pyridinyl)pyridine (CAS 15862-18-7) is a chemical compound with the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. IUPAC name: 5-bromo-2-(5-bromo-2-pyridinyl)pyridine. InChIKey: JNWPRPLNUUMYCM-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2 |
|---|---|
| Molecular weight | 313.98 g/mol |
| IUPAC name | 5-bromo-2-(5-bromo-2-pyridinyl)pyridine |
| InChIKey | JNWPRPLNUUMYCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)