CAS 942206-14-6 is the registry number for 4,6'-Dibromo-2,3'-bipyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
2-bromo-5-(4-bromo-2-pyridinyl)pyridine (CAS 942206-14-6) is a chemical compound with the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. IUPAC name: 2-bromo-5-(4-bromo-2-pyridinyl)pyridine. InChIKey: CANAGWONSFPODO-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2 |
|---|---|
| Molecular weight | 313.98 g/mol |
| IUPAC name | 2-bromo-5-(4-bromo-2-pyridinyl)pyridine |
| InChIKey | CANAGWONSFPODO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=NC=CC(=C2)Br)Br |
Computed by PubChem (NCBI)