Products 69112-08-9
CAS 69112-08-9 appears in our catalog under these names: 3,3'-Dibromo-4,4'-bipyridine, 3,3'-Dibromo-4,4'-bipyridine 95%, 3,3'-Dibromo-4,4'-bipyridine, 95%, 95%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 750mg, 100mg, 250mg, 1g, 5g.
3-bromo-4-(3-bromo-4-pyridinyl)pyridine (CAS 69112-08-9) is a chemical compound with the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. IUPAC name: 3-bromo-4-(3-bromo-4-pyridinyl)pyridine. InChIKey: HNWAZWIFVJLUPZ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2 |
|---|---|
| Molecular weight | 313.98 g/mol |
| IUPAC name | 3-bromo-4-(3-bromo-4-pyridinyl)pyridine |
| InChIKey | HNWAZWIFVJLUPZ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=C(C=NC=C2)Br)Br |
Computed by PubChem (NCBI)