CAS 64163-10-6 appears in our catalog under these names: 2,5-Dibromo-3-phenylpyrazine, 95%, 2,5–Dibromo–3–phenylpyrazine, Pyrazine, 2,5-Dibromo-3-Phenyl-, 95%, 95%, PYRAZINE, 2,5-DIBROMO-3-PHENYL-, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,5-dibromo-3-phenylpyrazine (CAS 64163-10-6) is a chemical compound with the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. IUPAC name: 2,5-dibromo-3-phenylpyrazine. InChIKey: YDDLKNUEOINATJ-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2 |
|---|---|
| Molecular weight | 313.98 g/mol |
| IUPAC name | 2,5-dibromo-3-phenylpyrazine |
| InChIKey | YDDLKNUEOINATJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CN=C2Br)Br |
Computed by PubChem (NCBI)