CAS 18511-71-2 appears in our catalog under these names: 4,4'–Dibromo–2,2'–bipyridine, 4,4'-Dibromo-2,2'-bipyridine, 4,4'-Dibromo-2,2'-bipyridyl, >97.0%(GC)(T), 4,4'-Dibromo-2,2'-bipyridine, 98%, 4,4'-Dibromo-2,2'-bipyridine 98%. Offered by: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 10g, 25g, 5g, 2g, 1g, 500g, 100mg, 100g.
4-bromo-2-(4-bromo-2-pyridinyl)pyridine (CAS 18511-71-2) is a chemical compound with the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. IUPAC name: 4-bromo-2-(4-bromo-2-pyridinyl)pyridine. InChIKey: KIIHBDSNVJRWFY-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2 |
|---|---|
| Molecular weight | 313.98 g/mol |
| IUPAC name | 4-bromo-2-(4-bromo-2-pyridinyl)pyridine |
| InChIKey | KIIHBDSNVJRWFY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Br)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)