CAS 158944-59-3 is the registry number for 2-Phenyl-2,3-dihydro-1H-isoindol-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-phenyl-1,3-dihydroisoindol-5-amine (CAS 158944-59-3) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 2-phenyl-1,3-dihydroisoindol-5-amine. InChIKey: BJTCEQMNWZXCGG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-phenyl-1,3-dihydroisoindol-5-amine |
| InChIKey | BJTCEQMNWZXCGG-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1C3=CC=CC=C3)C=C(C=C2)N |
Computed by PubChem (NCBI)