CAS 15914-23-5 is the registry number for 1,2-Dimethylchrysene. Offered by: TRC. Available pack sizes: 500mg.
1,2-dimethylchrysene (CAS 15914-23-5) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 1,2-dimethylchrysene. InChIKey: DSPSZYVTOBHKHQ-UHFFFAOYSA-N.
| Molecular formula | C20H16 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1,2-dimethylchrysene |
| InChIKey | DSPSZYVTOBHKHQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C3=C(C=C2)C4=CC=CC=C4C=C3)C |
Computed by PubChem (NCBI)