CAS 857535-92-3 is the registry number for 2,7-Dimethylbenz(a)anthracene. Offered by: TRC. Available pack sizes: 50mg.
2,7-dimethylbenzo[a]anthracene (CAS 857535-92-3) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 2,7-dimethylbenzo[a]anthracene. InChIKey: CWQBKKYXTKBXJV-UHFFFAOYSA-N.
| Molecular formula | C20H16 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 2,7-dimethylbenzo[a]anthracene |
| InChIKey | CWQBKKYXTKBXJV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC3=C(C4=CC=CC=C4C=C32)C |
Computed by PubChem (NCBI)