Products 21175-18-8

CAS 21175-18-8 is the registry number for (E)-4-Phenylstilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.

Structural formula: {0} (CAS {1})

1-phenyl-4-[(E)-2-phenylethenyl]benzene (CAS 21175-18-8) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 1-phenyl-4-[(E)-2-phenylethenyl]benzene. InChIKey: RTCXQMFXAWOHKN-VAWYXSNFSA-N.

Identity
Molecular formulaC20H16
Molecular weight256.3 g/mol
IUPAC name1-phenyl-4-[(E)-2-phenylethenyl]benzene
InChIKeyRTCXQMFXAWOHKN-VAWYXSNFSA-N
SMILESC1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)