CAS 21175-18-8 is the registry number for (E)-4-Phenylstilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
1-phenyl-4-[(E)-2-phenylethenyl]benzene (CAS 21175-18-8) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 1-phenyl-4-[(E)-2-phenylethenyl]benzene. InChIKey: RTCXQMFXAWOHKN-VAWYXSNFSA-N.
| Molecular formula | C20H16 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1-phenyl-4-[(E)-2-phenylethenyl]benzene |
| InChIKey | RTCXQMFXAWOHKN-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)