CAS 6705-11-9 is the registry number for 1-Ethylchrysene. Offered by: TRC. Available pack sizes: 250mg.
1-ethylchrysene (CAS 6705-11-9) is a chemical compound with the molecular formula C20H16 and a molecular weight of 256.3 g/mol. IUPAC name: 1-ethylchrysene. InChIKey: TWOSGOLFNJPHJX-UHFFFAOYSA-N.
| Molecular formula | C20H16 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1-ethylchrysene |
| InChIKey | TWOSGOLFNJPHJX-UHFFFAOYSA-N |
| SMILES | CCC1=C2C=CC3=C(C2=CC=C1)C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)